C25H35N5O3S — CID 42677158
N-tert-butyl-4-[4-[[2-[propyl(thiophene-2-carbonyl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide (PubChem CID 42677158) has the molecular formula C25H35N5O3S and a molecular weight of 485.65 g/mol. Its IUPAC name is N-tert-butyl-4-[4-[[2-[propyl(thiophene-2-carbonyl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-[4-[[2-[propyl(thiophene-2-carbonyl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42677158 |
| Molecular Formula | C25H35N5O3S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | N-tert-butyl-4-[4-[[2-[propyl(thiophene-2-carbonyl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(N2CCN(C(=O)NC(C)(C)C)CC2)cc1)C(=O)c1cccs1 |
| InChI | InChI=1S/C25H35N5O3S/c1-5-12-30(23(32)21-7-6-17-34-21)18-22(31)26-19-8-10-20(11-9-19)28-13-15-29(16-14-28)24(33)27-25(2,3)4/h6-11,17H,5,12-16,18H2,1-4H3,(H,26,31)(H,27,33) |
| InChIKey | HWSSTFALJKFFNQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|