C24H39N5O3 — CID 42677144
N-tert-butyl-4-[4-[[2-[2-methylpropanoyl(propan-2-yl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide (PubChem CID 42677144) has the molecular formula C24H39N5O3 and a molecular weight of 445.61 g/mol. Its IUPAC name is N-tert-butyl-4-[4-[[2-[2-methylpropanoyl(propan-2-yl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-[4-[[2-[2-methylpropanoyl(propan-2-yl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42677144 |
| Molecular Formula | C24H39N5O3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | N-tert-butyl-4-[4-[[2-[2-methylpropanoyl(propan-2-yl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide |
| SMILES | CC(C)C(=O)N(CC(=O)Nc1ccc(N2CCN(C(=O)NC(C)(C)C)CC2)cc1)C(C)C |
| InChI | InChI=1S/C24H39N5O3/c1-17(2)22(31)29(18(3)4)16-21(30)25-19-8-10-20(11-9-19)27-12-14-28(15-13-27)23(32)26-24(5,6)7/h8-11,17-18H,12-16H2,1-7H3,(H,25,30)(H,26,32) |
| InChIKey | HUUGRWVGKNWIDP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|