C17H17N3OS — CID 4267746
2-(naphthalen-1-ylamino)-N-propyl-1,3-thiazole-4-carboxamide (PubChem CID 4267746) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-(naphthalen-1-ylamino)-N-propyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(naphthalen-1-ylamino)-N-propyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4267746 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-(naphthalen-1-ylamino)-N-propyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCNC(=O)c1csc(Nc2cccc3ccccc23)n1 |
| InChI | InChI=1S/C17H17N3OS/c1-2-10-18-16(21)15-11-22-17(20-15)19-14-9-5-7-12-6-3-4-8-13(12)14/h3-9,11H,2,10H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | DBADXOQEVUNXBR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |