C20H13F2N3O2 — CID 42687666
2,6-difluoro-N-[5-(furan-2-yl)-3-phenyl-1H-pyrazol-4-yl]benzamide (PubChem CID 42687666) has the molecular formula C20H13F2N3O2 and a molecular weight of 365.34 g/mol. Its IUPAC name is 2,6-difluoro-N-[5-(furan-2-yl)-3-phenyl-1H-pyrazol-4-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[5-(furan-2-yl)-3-phenyl-1H-pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 42687666 |
| Molecular Formula | C20H13F2N3O2 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2,6-difluoro-N-[5-(furan-2-yl)-3-phenyl-1H-pyrazol-4-yl]benzamide |
| SMILES | O=C(Nc1c(-c2ccccc2)n[nH]c1-c1ccco1)c1c(F)cccc1F |
| InChI | InChI=1S/C20H13F2N3O2/c21-13-8-4-9-14(22)16(13)20(26)23-19-17(12-6-2-1-3-7-12)24-25-18(19)15-10-5-11-27-15/h1-11H,(H,23,26)(H,24,25) |
| InChIKey | AQHFSMKYASRXGJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |