C21H15ClN2O2 — CID 42692446
5-(3-chlorophenyl)-3-[(2-phenylphenoxy)methyl]-1,2,4-oxadiazole (PubChem CID 42692446) has the molecular formula C21H15ClN2O2 and a molecular weight of 362.82 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3-[(2-phenylphenoxy)methyl]-1,2,4-oxadiazole.
| Compound Name | 5-(3-chlorophenyl)-3-[(2-phenylphenoxy)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 42692446 |
| Molecular Formula | C21H15ClN2O2 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 5-(3-chlorophenyl)-3-[(2-phenylphenoxy)methyl]-1,2,4-oxadiazole |
| SMILES | Clc1cccc(-c2nc(COc3ccccc3-c3ccccc3)no2)c1 |
| InChI | InChI=1S/C21H15ClN2O2/c22-17-10-6-9-16(13-17)21-23-20(24-26-21)14-25-19-12-5-4-11-18(19)15-7-2-1-3-8-15/h1-13H,14H2 |
| InChIKey | DMCWZYRPRAMJRM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |