C12H11ClN2O3 — CID 151970918
2-[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethyl acetate (PubChem CID 151970918) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethyl acetate.
| Compound Name | 2-[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethyl acetate |
|---|---|
| PubChem CID | 151970918 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethyl acetate |
| SMILES | CC(=O)OCCc1noc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C12H11ClN2O3/c1-8(16)17-6-5-11-14-12(18-15-11)9-3-2-4-10(13)7-9/h2-4,7H,5-6H2,1H3 |
| InChIKey | UAQPNKVCEZACCQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |