C25H24FN3O — CID 42695619
3-benzyl-1-[(2-fluorophenyl)methyl]-1-[2-(1H-indol-3-yl)ethyl]urea (PubChem CID 42695619) has the molecular formula C25H24FN3O and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-benzyl-1-[(2-fluorophenyl)methyl]-1-[2-(1H-indol-3-yl)ethyl]urea.
| Compound Name | 3-benzyl-1-[(2-fluorophenyl)methyl]-1-[2-(1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 42695619 |
| Molecular Formula | C25H24FN3O |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-benzyl-1-[(2-fluorophenyl)methyl]-1-[2-(1H-indol-3-yl)ethyl]urea |
| SMILES | O=C(NCc1ccccc1)N(CCc1c[nH]c2ccccc12)Cc1ccccc1F |
| InChI | InChI=1S/C25H24FN3O/c26-23-12-6-4-10-21(23)18-29(25(30)28-16-19-8-2-1-3-9-19)15-14-20-17-27-24-13-7-5-11-22(20)24/h1-13,17,27H,14-16,18H2,(H,28,30) |
| InChIKey | RVEGOYRBUIKHNG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |