C27H28Cl2N4O2 — CID 42696639
1-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopropan-2-yl]-3-(2,4-dichlorophenyl)urea (PubChem CID 42696639) has the molecular formula C27H28Cl2N4O2 and a molecular weight of 511.45 g/mol. Its IUPAC name is 1-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopropan-2-yl]-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopropan-2-yl]-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 42696639 |
| Molecular Formula | C27H28Cl2N4O2 |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 1-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopropan-2-yl]-3-(2,4-dichlorophenyl)urea |
| SMILES | CC(NC(=O)Nc1ccc(Cl)cc1Cl)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H28Cl2N4O2/c1-19(30-27(35)31-24-13-12-22(28)18-23(24)29)26(34)33-16-14-32(15-17-33)25(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-13,18-19,25H,14-17H2,1H3,(H2,30,31,35) |
| InChIKey | JKJKDQZIHCPZMF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |