C20H30N2O3 — CID 42698446
ethyl 3-[cyclohexyl-[(4-ethylphenyl)carbamoyl]amino]propanoate (PubChem CID 42698446) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is ethyl 3-[cyclohexyl-[(4-ethylphenyl)carbamoyl]amino]propanoate.
| Compound Name | ethyl 3-[cyclohexyl-[(4-ethylphenyl)carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 42698446 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | ethyl 3-[cyclohexyl-[(4-ethylphenyl)carbamoyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)Nc1ccc(CC)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H30N2O3/c1-3-16-10-12-17(13-11-16)21-20(24)22(15-14-19(23)25-4-2)18-8-6-5-7-9-18/h10-13,18H,3-9,14-15H2,1-2H3,(H,21,24) |
| InChIKey | OYNWMIZQWGHKFE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |