C20H31N3O3 — CID 4095855
4-[(4-ethylphenyl)carbamoyl-(3-methylbutyl)amino]piperidine-1-carboxylic acid (PubChem CID 4095855) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-[(4-ethylphenyl)carbamoyl-(3-methylbutyl)amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[(4-ethylphenyl)carbamoyl-(3-methylbutyl)amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 4095855 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 4-[(4-ethylphenyl)carbamoyl-(3-methylbutyl)amino]piperidine-1-carboxylic acid |
| SMILES | CCc1ccc(NC(=O)N(CCC(C)C)C2CCN(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C20H31N3O3/c1-4-16-5-7-17(8-6-16)21-19(24)23(14-9-15(2)3)18-10-12-22(13-11-18)20(25)26/h5-8,15,18H,4,9-14H2,1-3H3,(H,21,24)(H,25,26) |
| InChIKey | WABKDBYHPMGNMV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |