C17H25N3O5 — CID 68962780
4-[2,2-dimethoxyethyl(phenylcarbamoyl)amino]piperidine-1-carboxylic acid (PubChem CID 68962780) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is 4-[2,2-dimethoxyethyl(phenylcarbamoyl)amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[2,2-dimethoxyethyl(phenylcarbamoyl)amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68962780 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 4-[2,2-dimethoxyethyl(phenylcarbamoyl)amino]piperidine-1-carboxylic acid |
| SMILES | COC(CN(C(=O)Nc1ccccc1)C1CCN(C(=O)O)CC1)OC |
| InChI | InChI=1S/C17H25N3O5/c1-24-15(25-2)12-20(14-8-10-19(11-9-14)17(22)23)16(21)18-13-6-4-3-5-7-13/h3-7,14-15H,8-12H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | WLLYLQODBORGQF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|