About 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid
4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid (PubChem CID 18173657) has the molecular formula C22H33N3O5
and a molecular weight of 419.52 g/mol. Its IUPAC name is 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid |
| PubChem CID | 18173657 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid |
| SMILES | COC(Cc1ccc(NC2CCN(C(=O)C3CCN(C(=O)O)CC3)CC2)cc1)OC |
| InChI | InChI=1S/C22H33N3O5/c1-29-20(30-2)15-16-3-5-18(6-4-16)23-19-9-13-24(14-10-19)21(26)17-7-11-25(12-8-17)22(27)28/h3-6,17,19-20,23H,7-15H2,1-2H3,(H,27,28) |
| InChIKey | ITXDDYMVJIPIFB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid?
The IUPAC name of 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid (CID 18173657) is 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid.
What is the SMILES notation for 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid?
The canonical SMILES for 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid is COC(Cc1ccc(NC2CCN(C(=O)C3CCN(C(=O)O)CC3)CC2)cc1)OC.
What is the InChIKey of 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid?
The InChIKey is ITXDDYMVJIPIFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33N3O5/c1-29-20(30-2)15-16-3-5-18(6-4-16)23-19-9-13-24(14-10-19)21(26)17-7-11-25(12-8-17)22(27)28/h3-6,17,19-20,23H,7-15H2,1-2H3,(H,27,28).
What are the key properties of 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid?
4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid has a molecular weight of 419.52 g/mol, XLogP of 2.64, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid is sourced from PubChem (CID 18173657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).