C22H33N3O5 — CID 18173657
4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid (PubChem CID 18173657) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 18173657 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 4-[4-[4-(2,2-dimethoxyethyl)anilino]piperidine-1-carbonyl]piperidine-1-carboxylic acid |
| SMILES | COC(Cc1ccc(NC2CCN(C(=O)C3CCN(C(=O)O)CC3)CC2)cc1)OC |
| InChI | InChI=1S/C22H33N3O5/c1-29-20(30-2)15-16-3-5-18(6-4-16)23-19-9-13-24(14-10-19)21(26)17-7-11-25(12-8-17)22(27)28/h3-6,17,19-20,23H,7-15H2,1-2H3,(H,27,28) |
| InChIKey | ITXDDYMVJIPIFB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|