C17H24N2O3 — CID 175226509
4-[benzoyl(tert-butyl)amino]piperidine-1-carboxylic acid (PubChem CID 175226509) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[benzoyl(tert-butyl)amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[benzoyl(tert-butyl)amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175226509 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 4-[benzoyl(tert-butyl)amino]piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)N(C(=O)c1ccccc1)C1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-17(2,3)19(15(20)13-7-5-4-6-8-13)14-9-11-18(12-10-14)16(21)22/h4-8,14H,9-12H2,1-3H3,(H,21,22) |
| InChIKey | IOTHWDKNKJAEHE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |