C22H28N4O4 — CID 42699755
1-(1,3-benzodioxol-5-yl)-1-[4-(phenylcarbamoylamino)butyl]-3-propan-2-ylurea (PubChem CID 42699755) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-1-[4-(phenylcarbamoylamino)butyl]-3-propan-2-ylurea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-1-[4-(phenylcarbamoylamino)butyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 42699755 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-1-[4-(phenylcarbamoylamino)butyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N(CCCCNC(=O)Nc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H28N4O4/c1-16(2)24-22(28)26(18-10-11-19-20(14-18)30-15-29-19)13-7-6-12-23-21(27)25-17-8-4-3-5-9-17/h3-5,8-11,14,16H,6-7,12-13,15H2,1-2H3,(H,24,28)(H2,23,25,27) |
| InChIKey | PJSBSBYXMTTXEH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|