C20H31N3O4 — CID 42699730
N-[4-[1,3-benzodioxol-5-yl(ethylcarbamoyl)amino]butyl]hexanamide (PubChem CID 42699730) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[4-[1,3-benzodioxol-5-yl(ethylcarbamoyl)amino]butyl]hexanamide.
| Compound Name | N-[4-[1,3-benzodioxol-5-yl(ethylcarbamoyl)amino]butyl]hexanamide |
|---|---|
| PubChem CID | 42699730 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | N-[4-[1,3-benzodioxol-5-yl(ethylcarbamoyl)amino]butyl]hexanamide |
| SMILES | CCCCCC(=O)NCCCCN(C(=O)NCC)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H31N3O4/c1-3-5-6-9-19(24)22-12-7-8-13-23(20(25)21-4-2)16-10-11-17-18(14-16)27-15-26-17/h10-11,14H,3-9,12-13,15H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | OTZFJTSQYPVUIE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|