C29H33ClN2O2 — CID 42704128
N-[1-[benzyl(2-phenylethyl)amino]-1-oxo-3-phenylpropan-2-yl]-3-chloro-2,2-dimethylpropanamide (PubChem CID 42704128) has the molecular formula C29H33ClN2O2 and a molecular weight of 477.05 g/mol. Its IUPAC name is N-[1-[benzyl(2-phenylethyl)amino]-1-oxo-3-phenylpropan-2-yl]-3-chloro-2,2-dimethylpropanamide.
| Compound Name | N-[1-[benzyl(2-phenylethyl)amino]-1-oxo-3-phenylpropan-2-yl]-3-chloro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 42704128 |
| Molecular Formula | C29H33ClN2O2 |
| Molecular Weight | 477.05 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | N-[1-[benzyl(2-phenylethyl)amino]-1-oxo-3-phenylpropan-2-yl]-3-chloro-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)NC(Cc1ccccc1)C(=O)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H33ClN2O2/c1-29(2,22-30)28(34)31-26(20-24-14-8-4-9-15-24)27(33)32(21-25-16-10-5-11-17-25)19-18-23-12-6-3-7-13-23/h3-17,26H,18-22H2,1-2H3,(H,31,34) |
| InChIKey | BEAAKNCIZVQJIE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.05 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|