C27H26FN3O4S — CID 42705441
1-[3-(4-fluoro-N-naphthalen-2-ylsulfonylanilino)propyl]-3-(3-methoxyphenyl)urea (PubChem CID 42705441) has the molecular formula C27H26FN3O4S and a molecular weight of 507.59 g/mol. Its IUPAC name is 1-[3-(4-fluoro-N-naphthalen-2-ylsulfonylanilino)propyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[3-(4-fluoro-N-naphthalen-2-ylsulfonylanilino)propyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 42705441 |
| Molecular Formula | C27H26FN3O4S |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 1-[3-(4-fluoro-N-naphthalen-2-ylsulfonylanilino)propyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NCCCN(c2ccc(F)cc2)S(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C27H26FN3O4S/c1-35-25-9-4-8-23(19-25)30-27(32)29-16-5-17-31(24-13-11-22(28)12-14-24)36(33,34)26-15-10-20-6-2-3-7-21(20)18-26/h2-4,6-15,18-19H,5,16-17H2,1H3,(H2,29,30,32) |
| InChIKey | JMEZFTJJSRPXGC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|