C23H23ClFN3O3S — CID 42705753
1-[3-(N-(4-chlorophenyl)sulfonyl-4-fluoroanilino)propyl]-3-(2-methylphenyl)urea (PubChem CID 42705753) has the molecular formula C23H23ClFN3O3S and a molecular weight of 475.97 g/mol. Its IUPAC name is 1-[3-(N-(4-chlorophenyl)sulfonyl-4-fluoroanilino)propyl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[3-(N-(4-chlorophenyl)sulfonyl-4-fluoroanilino)propyl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 42705753 |
| Molecular Formula | C23H23ClFN3O3S |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 1-[3-(N-(4-chlorophenyl)sulfonyl-4-fluoroanilino)propyl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NCCCN(c1ccc(F)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClFN3O3S/c1-17-5-2-3-6-22(17)27-23(29)26-15-4-16-28(20-11-9-19(25)10-12-20)32(30,31)21-13-7-18(24)8-14-21/h2-3,5-14H,4,15-16H2,1H3,(H2,26,27,29) |
| InChIKey | GIRWSSIERLAONK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|