C25H40N2O2 — CID 42705710
N-phenyl-N-[3-(3,5,5-trimethylhexanoylamino)propyl]cyclohexanecarboxamide (PubChem CID 42705710) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is N-phenyl-N-[3-(3,5,5-trimethylhexanoylamino)propyl]cyclohexanecarboxamide.
| Compound Name | N-phenyl-N-[3-(3,5,5-trimethylhexanoylamino)propyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 42705710 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | N-phenyl-N-[3-(3,5,5-trimethylhexanoylamino)propyl]cyclohexanecarboxamide |
| SMILES | CC(CC(=O)NCCCN(C(=O)C1CCCCC1)c1ccccc1)CC(C)(C)C |
| InChI | InChI=1S/C25H40N2O2/c1-20(19-25(2,3)4)18-23(28)26-16-11-17-27(22-14-9-6-10-15-22)24(29)21-12-7-5-8-13-21/h6,9-10,14-15,20-21H,5,7-8,11-13,16-19H2,1-4H3,(H,26,28) |
| InChIKey | VZCPNJXAEXYYSU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|