C22H21BrFN3O — CID 42706350
3-(4-bromophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(4-fluorophenyl)urea (PubChem CID 42706350) has the molecular formula C22H21BrFN3O and a molecular weight of 442.33 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(4-fluorophenyl)urea.
| Compound Name | 3-(4-bromophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 42706350 |
| Molecular Formula | C22H21BrFN3O |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 3-(4-bromophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(4-fluorophenyl)urea |
| SMILES | CN(C)c1ccc(CN(C(=O)Nc2ccc(Br)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H21BrFN3O/c1-26(2)20-11-3-16(4-12-20)15-27(21-13-7-18(24)8-14-21)22(28)25-19-9-5-17(23)6-10-19/h3-14H,15H2,1-2H3,(H,25,28) |
| InChIKey | DSTKWXIEZWYRDN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|