C26H31FN4O — CID 42706509
1-[(2-fluorophenyl)methyl]-3-(4-methylphenyl)-1-[6-(pyridin-2-ylamino)hexyl]urea (PubChem CID 42706509) has the molecular formula C26H31FN4O and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-3-(4-methylphenyl)-1-[6-(pyridin-2-ylamino)hexyl]urea.
| Compound Name | 1-[(2-fluorophenyl)methyl]-3-(4-methylphenyl)-1-[6-(pyridin-2-ylamino)hexyl]urea |
|---|---|
| PubChem CID | 42706509 |
| Molecular Formula | C26H31FN4O |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-3-(4-methylphenyl)-1-[6-(pyridin-2-ylamino)hexyl]urea |
| SMILES | Cc1ccc(NC(=O)N(CCCCCCNc2ccccn2)Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C26H31FN4O/c1-21-13-15-23(16-14-21)30-26(32)31(20-22-10-4-5-11-24(22)27)19-9-3-2-7-17-28-25-12-6-8-18-29-25/h4-6,8,10-16,18H,2-3,7,9,17,19-20H2,1H3,(H,28,29)(H,30,32) |
| InChIKey | SKYLDLAFTQCXLY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|