C25H35N3O4 — CID 42707860
ethyl 4-[(2-methoxyphenyl)methyl-[6-(pyridin-2-ylamino)hexyl]amino]-4-oxobutanoate (PubChem CID 42707860) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is ethyl 4-[(2-methoxyphenyl)methyl-[6-(pyridin-2-ylamino)hexyl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[(2-methoxyphenyl)methyl-[6-(pyridin-2-ylamino)hexyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42707860 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | ethyl 4-[(2-methoxyphenyl)methyl-[6-(pyridin-2-ylamino)hexyl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(CCCCCCNc1ccccn1)Cc1ccccc1OC |
| InChI | InChI=1S/C25H35N3O4/c1-3-32-25(30)16-15-24(29)28(20-21-12-6-7-13-22(21)31-2)19-11-5-4-9-17-26-23-14-8-10-18-27-23/h6-8,10,12-14,18H,3-5,9,11,15-17,19-20H2,1-2H3,(H,26,27) |
| InChIKey | YWGRWISFBHKYMI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|