C21H24ClFN2O2 — CID 42707122
N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]-N-(4-fluorophenyl)-2-methylbenzamide (PubChem CID 42707122) has the molecular formula C21H24ClFN2O2 and a molecular weight of 390.89 g/mol. Its IUPAC name is N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]-N-(4-fluorophenyl)-2-methylbenzamide.
| Compound Name | N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]-N-(4-fluorophenyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 42707122 |
| Molecular Formula | C21H24ClFN2O2 |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-[2-[(3-chloro-2,2-dimethylpropanoyl)amino]ethyl]-N-(4-fluorophenyl)-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(CCNC(=O)C(C)(C)CCl)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24ClFN2O2/c1-15-6-4-5-7-18(15)19(26)25(17-10-8-16(23)9-11-17)13-12-24-20(27)21(2,3)14-22/h4-11H,12-14H2,1-3H3,(H,24,27) |
| InChIKey | DVQPMMKCXIWETO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|