C23H38N2O — CID 42708114
N-[(4-methylphenyl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]hexanamide (PubChem CID 42708114) has the molecular formula C23H38N2O and a molecular weight of 358.57 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]hexanamide.
| Compound Name | N-[(4-methylphenyl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]hexanamide |
|---|---|
| PubChem CID | 42708114 |
| Molecular Formula | C23H38N2O |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.30 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-N-[3-(2-methylpiperidin-1-yl)propyl]hexanamide |
| SMILES | CCCCCC(=O)N(CCCN1CCCCC1C)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C23H38N2O/c1-4-5-6-11-23(26)25(19-22-14-12-20(2)13-15-22)18-9-17-24-16-8-7-10-21(24)3/h12-15,21H,4-11,16-19H2,1-3H3 |
| InChIKey | SOXHCQCSFKQWKX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|