C23H29Cl2N3O — CID 42708840
3-(3-chlorophenyl)-1-[(4-chlorophenyl)methyl]-1-[3-(2-methylpiperidin-1-yl)propyl]urea (PubChem CID 42708840) has the molecular formula C23H29Cl2N3O and a molecular weight of 434.41 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(4-chlorophenyl)methyl]-1-[3-(2-methylpiperidin-1-yl)propyl]urea.
| Compound Name | 3-(3-chlorophenyl)-1-[(4-chlorophenyl)methyl]-1-[3-(2-methylpiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 42708840 |
| Molecular Formula | C23H29Cl2N3O |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(4-chlorophenyl)methyl]-1-[3-(2-methylpiperidin-1-yl)propyl]urea |
| SMILES | CC1CCCCN1CCCN(Cc1ccc(Cl)cc1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H29Cl2N3O/c1-18-6-2-3-13-27(18)14-5-15-28(17-19-9-11-20(24)12-10-19)23(29)26-22-8-4-7-21(25)16-22/h4,7-12,16,18H,2-3,5-6,13-15,17H2,1H3,(H,26,29) |
| InChIKey | UGNMRGOMMBLJLL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |