C29H38N6O4 — CID 42708893
N-butyl-4-[3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)carbamoylamino]propanoyl]-2-methylpiperazine-1-carboxamide (PubChem CID 42708893) has the molecular formula C29H38N6O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is N-butyl-4-[3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)carbamoylamino]propanoyl]-2-methylpiperazine-1-carboxamide.
| Compound Name | N-butyl-4-[3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)carbamoylamino]propanoyl]-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42708893 |
| Molecular Formula | C29H38N6O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | N-butyl-4-[3-(1H-indol-3-yl)-2-[(4-methoxyphenyl)carbamoylamino]propanoyl]-2-methylpiperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(C(=O)C(Cc2c[nH]c3ccccc23)NC(=O)Nc2ccc(OC)cc2)CC1C |
| InChI | InChI=1S/C29H38N6O4/c1-4-5-14-30-29(38)35-16-15-34(19-20(35)2)27(36)26(17-21-18-31-25-9-7-6-8-24(21)25)33-28(37)32-22-10-12-23(39-3)13-11-22/h6-13,18,20,26,31H,4-5,14-17,19H2,1-3H3,(H,30,38)(H2,32,33,37) |
| InChIKey | KBJRRLOKZUEPNF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|