C22H24ClN3O4 — CID 42708925
4-chloro-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropyl]-3-nitro-N-propylbenzamide (PubChem CID 42708925) has the molecular formula C22H24ClN3O4 and a molecular weight of 429.90 g/mol. Its IUPAC name is 4-chloro-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropyl]-3-nitro-N-propylbenzamide.
| Compound Name | 4-chloro-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropyl]-3-nitro-N-propylbenzamide |
|---|---|
| PubChem CID | 42708925 |
| Molecular Formula | C22H24ClN3O4 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 4-chloro-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropyl]-3-nitro-N-propylbenzamide |
| SMILES | CCCN(CCC(=O)N1CCc2ccccc2C1)C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24ClN3O4/c1-2-11-24(22(28)17-7-8-19(23)20(14-17)26(29)30)13-10-21(27)25-12-9-16-5-3-4-6-18(16)15-25/h3-8,14H,2,9-13,15H2,1H3 |
| InChIKey | QJUIOTOAGRIJOI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|