C26H31N3O6 — CID 42708981
(E)-N-butyl-N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 42708981) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is (E)-N-butyl-N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-butyl-N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 42708981 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (E)-N-butyl-N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCCCN(CC(=O)N1CCc2cc(OC)c(OC)cc2C1)C(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H31N3O6/c1-4-5-13-27(25(30)11-8-19-6-9-22(10-7-19)29(32)33)18-26(31)28-14-12-20-15-23(34-2)24(35-3)16-21(20)17-28/h6-11,15-16H,4-5,12-14,17-18H2,1-3H3/b11-8+ |
| InChIKey | QEFFYFICVAPQRK-DHZHZOJOSA-N |
| XLogP | 3.84 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|