C27H25N3O2 — CID 42711543
(E)-N-benzyl-N-[1-(3-methyl-4-oxoquinazolin-2-yl)ethyl]-3-phenylprop-2-enamide (PubChem CID 42711543) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is (E)-N-benzyl-N-[1-(3-methyl-4-oxoquinazolin-2-yl)ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-benzyl-N-[1-(3-methyl-4-oxoquinazolin-2-yl)ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42711543 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (E)-N-benzyl-N-[1-(3-methyl-4-oxoquinazolin-2-yl)ethyl]-3-phenylprop-2-enamide |
| SMILES | CC(c1nc2ccccc2c(=O)n1C)N(Cc1ccccc1)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C27H25N3O2/c1-20(26-28-24-16-10-9-15-23(24)27(32)29(26)2)30(19-22-13-7-4-8-14-22)25(31)18-17-21-11-5-3-6-12-21/h3-18,20H,19H2,1-2H3/b18-17+ |
| InChIKey | OBMBFNISUZHETB-ISLYRVAYSA-N |
| XLogP | 4.74 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|