C26H31ClN4O2 — CID 42717134
1-[1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-cyclohexyl-1-ethylurea (PubChem CID 42717134) has the molecular formula C26H31ClN4O2 and a molecular weight of 467.01 g/mol. Its IUPAC name is 1-[1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-cyclohexyl-1-ethylurea.
| Compound Name | 1-[1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-cyclohexyl-1-ethylurea |
|---|---|
| PubChem CID | 42717134 |
| Molecular Formula | C26H31ClN4O2 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 1-[1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-cyclohexyl-1-ethylurea |
| SMILES | CCN(C(=O)NC1CCCCC1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1C |
| InChI | InChI=1S/C26H31ClN4O2/c1-4-30(26(33)28-20-10-6-5-7-11-20)18(3)24-29-22-13-9-8-12-21(22)25(32)31(24)23-15-14-19(27)16-17(23)2/h8-9,12-16,18,20H,4-7,10-11H2,1-3H3,(H,28,33) |
| InChIKey | SWJJZLUOJAKZCB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |