C27H34N4O2 — CID 42722030
3-cyclohexyl-1-ethyl-1-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]urea (PubChem CID 42722030) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 3-cyclohexyl-1-ethyl-1-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]urea.
| Compound Name | 3-cyclohexyl-1-ethyl-1-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 42722030 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 3-cyclohexyl-1-ethyl-1-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]urea |
| SMILES | CCc1ccccc1-n1c(C(C)N(CC)C(=O)NC2CCCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H34N4O2/c1-4-20-13-9-12-18-24(20)31-25(29-23-17-11-10-16-22(23)26(31)32)19(3)30(5-2)27(33)28-21-14-7-6-8-15-21/h9-13,16-19,21H,4-8,14-15H2,1-3H3,(H,28,33) |
| InChIKey | MKMHNKJJOWPHJP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |