C30H30ClN5O5 — CID 42717280
2-[1-[4-(4-chloro-3-nitrobenzoyl)piperazin-1-yl]propyl]-3-(4-ethoxyphenyl)quinazolin-4-one (PubChem CID 42717280) has the molecular formula C30H30ClN5O5 and a molecular weight of 576.05 g/mol. Its IUPAC name is 2-[1-[4-(4-chloro-3-nitrobenzoyl)piperazin-1-yl]propyl]-3-(4-ethoxyphenyl)quinazolin-4-one.
| Compound Name | 2-[1-[4-(4-chloro-3-nitrobenzoyl)piperazin-1-yl]propyl]-3-(4-ethoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 42717280 |
| Molecular Formula | C30H30ClN5O5 |
| Molecular Weight | 576.05 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 2-[1-[4-(4-chloro-3-nitrobenzoyl)piperazin-1-yl]propyl]-3-(4-ethoxyphenyl)quinazolin-4-one |
| SMILES | CCOc1ccc(-n2c(C(CC)N3CCN(C(=O)c4ccc(Cl)c([N+](=O)[O-])c4)CC3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C30H30ClN5O5/c1-3-26(33-15-17-34(18-16-33)29(37)20-9-14-24(31)27(19-20)36(39)40)28-32-25-8-6-5-7-23(25)30(38)35(28)21-10-12-22(13-11-21)41-4-2/h5-14,19,26H,3-4,15-18H2,1-2H3 |
| InChIKey | YJFBCNOSOHLNRE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.05 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|