C29H33N3O3 — CID 42720693
N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(furan-2-ylmethyl)hexanamide (PubChem CID 42720693) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(furan-2-ylmethyl)hexanamide.
| Compound Name | N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(furan-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 42720693 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(furan-2-ylmethyl)hexanamide |
| SMILES | CCCCCC(=O)N(Cc1ccco1)C(C)c1nc2ccccc2c(=O)n1-c1cc(C)ccc1C |
| InChI | InChI=1S/C29H33N3O3/c1-5-6-7-14-27(33)31(19-23-11-10-17-35-23)22(4)28-30-25-13-9-8-12-24(25)29(34)32(28)26-18-20(2)15-16-21(26)3/h8-13,15-18,22H,5-7,14,19H2,1-4H3 |
| InChIKey | KIJVWJXBOLPQTA-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|