C30H35N5O3 — CID 4272111
4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 4272111) has the molecular formula C30H35N5O3 and a molecular weight of 513.64 g/mol. Its IUPAC name is 4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 4272111 |
| Molecular Formula | C30H35N5O3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2ccc(N3C(=O)N4CCc5c([nH]c6ccccc56)C4(C)C3=O)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C30H35N5O3/c1-28(2)16-19(17-29(3,4)33-28)31-25(36)18-10-12-20(13-11-18)35-26(37)30(5)24-22(14-15-34(30)27(35)38)21-8-6-7-9-23(21)32-24/h6-13,19,32-33H,14-17H2,1-5H3,(H,31,36) |
| InChIKey | QBWORKFPQNFUED-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|