C33H26N4O4 — CID 3509444
4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(4-phenoxyphenyl)benzamide (PubChem CID 3509444) has the molecular formula C33H26N4O4 and a molecular weight of 542.60 g/mol. Its IUPAC name is 4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(4-phenoxyphenyl)benzamide.
| Compound Name | 4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 3509444 |
| Molecular Formula | C33H26N4O4 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(4-phenoxyphenyl)benzamide |
| SMILES | CC12C(=O)N(c3ccc(C(=O)Nc4ccc(Oc5ccccc5)cc4)cc3)C(=O)N1CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C33H26N4O4/c1-33-29-27(26-9-5-6-10-28(26)35-29)19-20-36(33)32(40)37(31(33)39)23-15-11-21(12-16-23)30(38)34-22-13-17-25(18-14-22)41-24-7-3-2-4-8-24/h2-18,35H,19-20H2,1H3,(H,34,38) |
| InChIKey | AOZRHCYBRAGBIK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|