C30H28N4O3 — CID 5112316
4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(4-propan-2-ylphenyl)benzamide (PubChem CID 5112316) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is 4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(4-propan-2-ylphenyl)benzamide.
| Compound Name | 4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(4-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 5112316 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 4-(2-methyl-3,5-dioxo-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),10,12,14-tetraen-4-yl)-N-(4-propan-2-ylphenyl)benzamide |
| SMILES | CC(C)c1ccc(NC(=O)c2ccc(N3C(=O)N4CCc5c([nH]c6ccccc56)C4(C)C3=O)cc2)cc1 |
| InChI | InChI=1S/C30H28N4O3/c1-18(2)19-8-12-21(13-9-19)31-27(35)20-10-14-22(15-11-20)34-28(36)30(3)26-24(16-17-33(30)29(34)37)23-6-4-5-7-25(23)32-26/h4-15,18,32H,16-17H2,1-3H3,(H,31,35) |
| InChIKey | SFTQXNCMBBLBMC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|