C30H39ClFN3O2 — CID 42721209
N-butyl-N-[1-[3-(3-chloro-4-fluorophenyl)-4-oxoquinazolin-2-yl]propyl]nonanamide (PubChem CID 42721209) has the molecular formula C30H39ClFN3O2 and a molecular weight of 528.11 g/mol. Its IUPAC name is N-butyl-N-[1-[3-(3-chloro-4-fluorophenyl)-4-oxoquinazolin-2-yl]propyl]nonanamide.
| Compound Name | N-butyl-N-[1-[3-(3-chloro-4-fluorophenyl)-4-oxoquinazolin-2-yl]propyl]nonanamide |
|---|---|
| PubChem CID | 42721209 |
| Molecular Formula | C30H39ClFN3O2 |
| Molecular Weight | 528.11 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-butyl-N-[1-[3-(3-chloro-4-fluorophenyl)-4-oxoquinazolin-2-yl]propyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCCC)C(CC)c1nc2ccccc2c(=O)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C30H39ClFN3O2/c1-4-7-9-10-11-12-17-28(36)34(20-8-5-2)27(6-3)29-33-26-16-14-13-15-23(26)30(37)35(29)22-18-19-25(32)24(31)21-22/h13-16,18-19,21,27H,4-12,17,20H2,1-3H3 |
| InChIKey | VNSJXVKEZBJDSO-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.11 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|