C29H32N4O3 — CID 42721341
1-benzyl-3-tert-butyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]urea (PubChem CID 42721341) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 1-benzyl-3-tert-butyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]urea.
| Compound Name | 1-benzyl-3-tert-butyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 42721341 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 1-benzyl-3-tert-butyl-1-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]urea |
| SMILES | COc1ccccc1-n1c(C(C)N(Cc2ccccc2)C(=O)NC(C)(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C29H32N4O3/c1-20(32(28(35)31-29(2,3)4)19-21-13-7-6-8-14-21)26-30-23-16-10-9-15-22(23)27(34)33(26)24-17-11-12-18-25(24)36-5/h6-18,20H,19H2,1-5H3,(H,31,35) |
| InChIKey | PSSBQQPDSZIJNL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |