C29H31N3O4 — CID 42721390
N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methoxyethyl)-2-phenoxyacetamide (PubChem CID 42721390) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methoxyethyl)-2-phenoxyacetamide.
| Compound Name | N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methoxyethyl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 42721390 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methoxyethyl)-2-phenoxyacetamide |
| SMILES | CCc1ccccc1-n1c(C(C)N(CCOC)C(=O)COc2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C29H31N3O4/c1-4-22-12-8-11-17-26(22)32-28(30-25-16-10-9-15-24(25)29(32)34)21(2)31(18-19-35-3)27(33)20-36-23-13-6-5-7-14-23/h5-17,21H,4,18-20H2,1-3H3 |
| InChIKey | GDPANTHXCDYGLJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |