C30H34N4O7S — CID 42724268
N-[(3,4-dimethoxyphenyl)methyl]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]-4-nitrobenzenesulfonamide (PubChem CID 42724268) has the molecular formula C30H34N4O7S and a molecular weight of 594.69 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 42724268 |
| Molecular Formula | C30H34N4O7S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-[4-[(6-methoxyquinolin-8-yl)amino]pentyl]-4-nitrobenzenesulfonamide |
| SMILES | COc1cc(NC(C)CCCN(Cc2ccc(OC)c(OC)c2)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)c2ncccc2c1 |
| InChI | InChI=1S/C30H34N4O7S/c1-21(32-27-19-25(39-2)18-23-8-5-15-31-30(23)27)7-6-16-33(20-22-9-14-28(40-3)29(17-22)41-4)42(37,38)26-12-10-24(11-13-26)34(35)36/h5,8-15,17-19,21,32H,6-7,16,20H2,1-4H3 |
| InChIKey | LOHFWAROKNVYBV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|