C28H28ClN3O4S — CID 42725822
N-[2-[4,5-bis(4-methoxyphenyl)-1-methylimidazol-2-yl]sulfanylethyl]-2-(4-chlorophenoxy)acetamide (PubChem CID 42725822) has the molecular formula C28H28ClN3O4S and a molecular weight of 538.07 g/mol. Its IUPAC name is N-[2-[4,5-bis(4-methoxyphenyl)-1-methylimidazol-2-yl]sulfanylethyl]-2-(4-chlorophenoxy)acetamide.
| Compound Name | N-[2-[4,5-bis(4-methoxyphenyl)-1-methylimidazol-2-yl]sulfanylethyl]-2-(4-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 42725822 |
| Molecular Formula | C28H28ClN3O4S |
| Molecular Weight | 538.07 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | N-[2-[4,5-bis(4-methoxyphenyl)-1-methylimidazol-2-yl]sulfanylethyl]-2-(4-chlorophenoxy)acetamide |
| SMILES | COc1ccc(-c2nc(SCCNC(=O)COc3ccc(Cl)cc3)n(C)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H28ClN3O4S/c1-32-27(20-6-12-23(35-3)13-7-20)26(19-4-10-22(34-2)11-5-19)31-28(32)37-17-16-30-25(33)18-36-24-14-8-21(29)9-15-24/h4-15H,16-18H2,1-3H3,(H,30,33) |
| InChIKey | AUAWMTYWCSYANK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.07 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|