C32H35N3O3 — CID 42727671
N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)-2-phenylcyclopropane-1-carboxamide (PubChem CID 42727671) has the molecular formula C32H35N3O3 and a molecular weight of 509.65 g/mol. Its IUPAC name is N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)-2-phenylcyclopropane-1-carboxamide.
| Compound Name | N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 42727671 |
| Molecular Formula | C32H35N3O3 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)-2-phenylcyclopropane-1-carboxamide |
| SMILES | COCCCN(C(=O)C1CC1c1ccccc1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C32H35N3O3/c1-21-15-16-25(19-22(21)2)35-30(33-29-14-9-8-13-26(29)32(35)37)23(3)34(17-10-18-38-4)31(36)28-20-27(28)24-11-6-5-7-12-24/h5-9,11-16,19,23,27-28H,10,17-18,20H2,1-4H3 |
| InChIKey | GFRMHBGOGRVZJJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|