C19H16Cl2N2O5S — CID 42728980
ethyl 3-(2-chloro-4-nitrobenzoyl)-2-(3-chlorophenyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 42728980) has the molecular formula C19H16Cl2N2O5S and a molecular weight of 455.32 g/mol. Its IUPAC name is ethyl 3-(2-chloro-4-nitrobenzoyl)-2-(3-chlorophenyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | ethyl 3-(2-chloro-4-nitrobenzoyl)-2-(3-chlorophenyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42728980 |
| Molecular Formula | C19H16Cl2N2O5S |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | ethyl 3-(2-chloro-4-nitrobenzoyl)-2-(3-chlorophenyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCOC(=O)C1CSC(c2cccc(Cl)c2)N1C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O5S/c1-2-28-19(25)16-10-29-18(11-4-3-5-12(20)8-11)22(16)17(24)14-7-6-13(23(26)27)9-15(14)21/h3-9,16,18H,2,10H2,1H3 |
| InChIKey | WOCDDCHLIYKCEX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|