C20H16ClF3N2O5S — CID 42658063
ethyl 3-(2-chloro-4-nitrobenzoyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine-4-carboxylate (PubChem CID 42658063) has the molecular formula C20H16ClF3N2O5S and a molecular weight of 488.87 g/mol. Its IUPAC name is ethyl 3-(2-chloro-4-nitrobenzoyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine-4-carboxylate.
| Compound Name | ethyl 3-(2-chloro-4-nitrobenzoyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42658063 |
| Molecular Formula | C20H16ClF3N2O5S |
| Molecular Weight | 488.87 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | ethyl 3-(2-chloro-4-nitrobenzoyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazolidine-4-carboxylate |
| SMILES | CCOC(=O)C1CSC(c2ccc(C(F)(F)F)cc2)N1C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C20H16ClF3N2O5S/c1-2-31-19(28)16-10-32-18(11-3-5-12(6-4-11)20(22,23)24)25(16)17(27)14-8-7-13(26(29)30)9-15(14)21/h3-9,16,18H,2,10H2,1H3 |
| InChIKey | OELAJCHGEYHRNP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.87 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|