C28H38N4O4 — CID 42743360
ethyl 4-[4-(4-hexylbenzoyl)-3-methylpiperazine-1-carbonyl]-2,6-dimethylpyrimidine-5-carboxylate (PubChem CID 42743360) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is ethyl 4-[4-(4-hexylbenzoyl)-3-methylpiperazine-1-carbonyl]-2,6-dimethylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[4-(4-hexylbenzoyl)-3-methylpiperazine-1-carbonyl]-2,6-dimethylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42743360 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | ethyl 4-[4-(4-hexylbenzoyl)-3-methylpiperazine-1-carbonyl]-2,6-dimethylpyrimidine-5-carboxylate |
| SMILES | CCCCCCc1ccc(C(=O)N2CCN(C(=O)c3nc(C)nc(C)c3C(=O)OCC)CC2C)cc1 |
| InChI | InChI=1S/C28H38N4O4/c1-6-8-9-10-11-22-12-14-23(15-13-22)26(33)32-17-16-31(18-19(32)3)27(34)25-24(28(35)36-7-2)20(4)29-21(5)30-25/h12-15,19H,6-11,16-18H2,1-5H3 |
| InChIKey | VDLODAIOSGABGT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|