C23H24Cl2N4O4 — CID 3258092
prop-2-enyl 4-[4-(3,4-dichlorobenzoyl)-3-methylpiperazine-1-carbonyl]-2,6-dimethylpyrimidine-5-carboxylate (PubChem CID 3258092) has the molecular formula C23H24Cl2N4O4 and a molecular weight of 491.38 g/mol. Its IUPAC name is prop-2-enyl 4-[4-(3,4-dichlorobenzoyl)-3-methylpiperazine-1-carbonyl]-2,6-dimethylpyrimidine-5-carboxylate.
| Compound Name | prop-2-enyl 4-[4-(3,4-dichlorobenzoyl)-3-methylpiperazine-1-carbonyl]-2,6-dimethylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3258092 |
| Molecular Formula | C23H24Cl2N4O4 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | prop-2-enyl 4-[4-(3,4-dichlorobenzoyl)-3-methylpiperazine-1-carbonyl]-2,6-dimethylpyrimidine-5-carboxylate |
| SMILES | C=CCOC(=O)c1c(C)nc(C)nc1C(=O)N1CCN(C(=O)c2ccc(Cl)c(Cl)c2)C(C)C1 |
| InChI | InChI=1S/C23H24Cl2N4O4/c1-5-10-33-23(32)19-14(3)26-15(4)27-20(19)22(31)28-8-9-29(13(2)12-28)21(30)16-6-7-17(24)18(25)11-16/h5-7,11,13H,1,8-10,12H2,2-4H3 |
| InChIKey | CUDBETORUOAVBR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|