C29H30N4O4 — CID 3967450
prop-2-enyl 4-methyl-6-[3-methyl-4-(2-phenylacetyl)piperazine-1-carbonyl]-2-phenylpyrimidine-5-carboxylate (PubChem CID 3967450) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-6-[3-methyl-4-(2-phenylacetyl)piperazine-1-carbonyl]-2-phenylpyrimidine-5-carboxylate.
| Compound Name | prop-2-enyl 4-methyl-6-[3-methyl-4-(2-phenylacetyl)piperazine-1-carbonyl]-2-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3967450 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | prop-2-enyl 4-methyl-6-[3-methyl-4-(2-phenylacetyl)piperazine-1-carbonyl]-2-phenylpyrimidine-5-carboxylate |
| SMILES | C=CCOC(=O)c1c(C)nc(-c2ccccc2)nc1C(=O)N1CCN(C(=O)Cc2ccccc2)C(C)C1 |
| InChI | InChI=1S/C29H30N4O4/c1-4-17-37-29(36)25-21(3)30-27(23-13-9-6-10-14-23)31-26(25)28(35)32-15-16-33(20(2)19-32)24(34)18-22-11-7-5-8-12-22/h4-14,20H,1,15-19H2,2-3H3 |
| InChIKey | SYGLMIKXZAHLIU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|