C21H24N4O3 — CID 42742233
prop-2-enyl 4-methyl-6-(3-methylpiperazine-1-carbonyl)-2-phenylpyrimidine-5-carboxylate (PubChem CID 42742233) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is prop-2-enyl 4-methyl-6-(3-methylpiperazine-1-carbonyl)-2-phenylpyrimidine-5-carboxylate.
| Compound Name | prop-2-enyl 4-methyl-6-(3-methylpiperazine-1-carbonyl)-2-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42742233 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | prop-2-enyl 4-methyl-6-(3-methylpiperazine-1-carbonyl)-2-phenylpyrimidine-5-carboxylate |
| SMILES | C=CCOC(=O)c1c(C)nc(-c2ccccc2)nc1C(=O)N1CCNC(C)C1 |
| InChI | InChI=1S/C21H24N4O3/c1-4-12-28-21(27)17-15(3)23-19(16-8-6-5-7-9-16)24-18(17)20(26)25-11-10-22-14(2)13-25/h4-9,14,22H,1,10-13H2,2-3H3 |
| InChIKey | PDAAGKLLAAEGGL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|