C26H28N4O4 — CID 42742025
ethyl 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-6-methyl-2-phenylpyrimidine-5-carboxylate (PubChem CID 42742025) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is ethyl 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-6-methyl-2-phenylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-6-methyl-2-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42742025 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | ethyl 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-6-methyl-2-phenylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(-c2ccccc2)nc1C(=O)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C26H28N4O4/c1-4-34-26(32)22-18(2)27-24(19-8-6-5-7-9-19)28-23(22)25(31)30-16-14-29(15-17-30)20-10-12-21(33-3)13-11-20/h5-13H,4,14-17H2,1-3H3 |
| InChIKey | XTZSTQJXRYWKMG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|