C28H30N4O4 — CID 42743347
prop-2-enyl 4-[4-(2-ethoxyphenyl)piperazine-1-carbonyl]-6-methyl-2-phenylpyrimidine-5-carboxylate (PubChem CID 42743347) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is prop-2-enyl 4-[4-(2-ethoxyphenyl)piperazine-1-carbonyl]-6-methyl-2-phenylpyrimidine-5-carboxylate.
| Compound Name | prop-2-enyl 4-[4-(2-ethoxyphenyl)piperazine-1-carbonyl]-6-methyl-2-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42743347 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | prop-2-enyl 4-[4-(2-ethoxyphenyl)piperazine-1-carbonyl]-6-methyl-2-phenylpyrimidine-5-carboxylate |
| SMILES | C=CCOC(=O)c1c(C)nc(-c2ccccc2)nc1C(=O)N1CCN(c2ccccc2OCC)CC1 |
| InChI | InChI=1S/C28H30N4O4/c1-4-19-36-28(34)24-20(3)29-26(21-11-7-6-8-12-21)30-25(24)27(33)32-17-15-31(16-18-32)22-13-9-10-14-23(22)35-5-2/h4,6-14H,1,5,15-19H2,2-3H3 |
| InChIKey | RPKFPYROQHJWQW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|